C20H28N2O6 — CID 177399741
methyl (Z)-2-[(S)-(methoxycarbonylamino)-(3-methylphenyl)methyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]but-2-enoate (PubChem CID 177399741) has the molecular formula C20H28N2O6 and a molecular weight of 392.45 g/mol. Its IUPAC name is methyl (Z)-2-[(S)-(methoxycarbonylamino)-(3-methylphenyl)methyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]but-2-enoate.
| Compound Name | methyl (Z)-2-[(S)-(methoxycarbonylamino)-(3-methylphenyl)methyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]but-2-enoate |
|---|---|
| PubChem CID | 177399741 |
| Molecular Formula | C20H28N2O6 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | methyl (Z)-2-[(S)-(methoxycarbonylamino)-(3-methylphenyl)methyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]but-2-enoate |
| SMILES | COC(=O)N[C@H](/C(C(=O)OC)=C(\C)NC(=O)OC(C)(C)C)c1cccc(C)c1 |
| InChI | InChI=1S/C20H28N2O6/c1-12-9-8-10-14(11-12)16(22-18(24)27-7)15(17(23)26-6)13(2)21-19(25)28-20(3,4)5/h8-11,16H,1-7H3,(H,21,25)(H,22,24)/b15-13-/t16-/m0/s1 |
| InChIKey | VRCIGMWOGLAFLX-KGAUPUERSA-N |
| XLogP | 3.36 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|