C13H11N3 — CID 177401459
2,3-dihydro-1H-pyrimido[1,2-a]quinoline-5-carbonitrile (PubChem CID 177401459) has the molecular formula C13H11N3 and a molecular weight of 209.25 g/mol. Its IUPAC name is 2,3-dihydro-1H-pyrimido[1,2-a]quinoline-5-carbonitrile.
| Compound Name | 2,3-dihydro-1H-pyrimido[1,2-a]quinoline-5-carbonitrile |
|---|---|
| PubChem CID | 177401459 |
| Molecular Formula | C13H11N3 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | 2,3-dihydro-1H-pyrimido[1,2-a]quinoline-5-carbonitrile |
| SMILES | N#CC1=Cc2ccccc2N2CCCN=C12 |
| InChI | InChI=1S/C13H11N3/c14-9-11-8-10-4-1-2-5-12(10)16-7-3-6-15-13(11)16/h1-2,4-5,8H,3,6-7H2 |
| InChIKey | ZGQRVGFCUUPXSB-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 39.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |