C20H17NO3 — CID 177402828
2-[(8-hydroxyquinolin-2-yl)methyl]-1-phenylbutane-1,3-dione (PubChem CID 177402828) has the molecular formula C20H17NO3 and a molecular weight of 319.36 g/mol. Its IUPAC name is 2-[(8-hydroxyquinolin-2-yl)methyl]-1-phenylbutane-1,3-dione.
| Compound Name | 2-[(8-hydroxyquinolin-2-yl)methyl]-1-phenylbutane-1,3-dione |
|---|---|
| PubChem CID | 177402828 |
| Molecular Formula | C20H17NO3 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 2-[(8-hydroxyquinolin-2-yl)methyl]-1-phenylbutane-1,3-dione |
| SMILES | CC(=O)C(Cc1ccc2cccc(O)c2n1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C20H17NO3/c1-13(22)17(20(24)15-6-3-2-4-7-15)12-16-11-10-14-8-5-9-18(23)19(14)21-16/h2-11,17,23H,12H2,1H3 |
| InChIKey | QIWUUAWXTIOCPQ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|