C14H18N2O3 — CID 91253152
(2S)-2-amino-3-(8-hydroxyquinolin-2-yl)propanoic acid;ethane (PubChem CID 91253152) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is (2S)-2-amino-3-(8-hydroxyquinolin-2-yl)propanoic acid;ethane.
| Compound Name | (2S)-2-amino-3-(8-hydroxyquinolin-2-yl)propanoic acid;ethane |
|---|---|
| PubChem CID | 91253152 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | (2S)-2-amino-3-(8-hydroxyquinolin-2-yl)propanoic acid;ethane |
| SMILES | CC.N[C@@H](Cc1ccc2cccc(O)c2n1)C(=O)O |
| InChI | InChI=1S/C12H12N2O3.C2H6/c13-9(12(16)17)6-8-5-4-7-2-1-3-10(15)11(7)14-8;1-2/h1-5,9,15H,6,13H2,(H,16,17);1-2H3/t9-;/m0./s1 |
| InChIKey | JTCCCEAQVHRZTD-FVGYRXGTSA-N |
| XLogP | 1.92 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |