About (2S)-2-aminopropanoic acid;cobalt;quinolin-8-ol
(2S)-2-aminopropanoic acid;cobalt;quinolin-8-ol (PubChem CID 11982278) has the molecular formula C12H14CoN2O3
and a molecular weight of 293.19 g/mol. Its IUPAC name is (2S)-2-aminopropanoic acid;cobalt;quinolin-8-ol.
Molecular Properties
| Compound Name | (2S)-2-aminopropanoic acid;cobalt;quinolin-8-ol |
| PubChem CID | 11982278 |
| Molecular Formula | C12H14CoN2O3 |
| Molecular Weight | 293.19 g/mol |
| Exact Mass | 293.03 |
| IUPAC Name | (2S)-2-aminopropanoic acid;cobalt;quinolin-8-ol |
| SMILES | C[C@H](N)C(=O)O.Oc1cccc2cccnc12.[Co] |
| InChI | InChI=1S/C9H7NO.C3H7NO2.Co/c11-8-5-1-3-7-4-2-6-10-9(7)8;1-2(4)3(5)6;/h1-6,11H;2H,4H2,1H3,(H,5,6);/t;2-;/m.0./s1 |
| InChIKey | NTWKBMYQPGCKIT-TYOUJGAFSA-N |
| XLogP | 1.36 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.19 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-2-aminopropanoic acid;cobalt;quinolin-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-aminopropanoic acid;cobalt;quinolin-8-ol?
The IUPAC name of (2S)-2-aminopropanoic acid;cobalt;quinolin-8-ol (CID 11982278) is (2S)-2-aminopropanoic acid;cobalt;quinolin-8-ol.
What is the SMILES notation for (2S)-2-aminopropanoic acid;cobalt;quinolin-8-ol?
The canonical SMILES for (2S)-2-aminopropanoic acid;cobalt;quinolin-8-ol is C[C@H](N)C(=O)O.Oc1cccc2cccnc12.[Co].
What is the InChIKey of (2S)-2-aminopropanoic acid;cobalt;quinolin-8-ol?
The InChIKey is NTWKBMYQPGCKIT-TYOUJGAFSA-N. The full InChI is InChI=1S/C9H7NO.C3H7NO2.Co/c11-8-5-1-3-7-4-2-6-10-9(7)8;1-2(4)3(5)6;/h1-6,11H;2H,4H2,1H3,(H,5,6);/t;2-;/m.0./s1.
What are the key properties of (2S)-2-aminopropanoic acid;cobalt;quinolin-8-ol?
(2S)-2-aminopropanoic acid;cobalt;quinolin-8-ol has a molecular weight of 293.19 g/mol, XLogP of 1.36, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-aminopropanoic acid;cobalt;quinolin-8-ol is sourced from PubChem (CID 11982278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).