About 2-[(E)-1H-imidazol-2-yldiazenyl]-1,3-thiazol-5-amine
2-[(E)-1H-imidazol-2-yldiazenyl]-1,3-thiazol-5-amine (PubChem CID 177404121) has the molecular formula C6H6N6S
and a molecular weight of 194.22 g/mol. Its IUPAC name is 2-[(E)-1H-imidazol-2-yldiazenyl]-1,3-thiazol-5-amine.
Molecular Properties
| Compound Name | 2-[(E)-1H-imidazol-2-yldiazenyl]-1,3-thiazol-5-amine |
| PubChem CID | 177404121 |
| Molecular Formula | C6H6N6S |
| Molecular Weight | 194.22 g/mol |
| Exact Mass | 194.04 |
| IUPAC Name | 2-[(E)-1H-imidazol-2-yldiazenyl]-1,3-thiazol-5-amine |
| SMILES | Nc1cnc(/N=N/c2ncc[nH]2)s1 |
| InChI | InChI=1S/C6H6N6S/c7-4-3-10-6(13-4)12-11-5-8-1-2-9-5/h1-3H,7H2,(H,8,9)/b12-11+ |
| InChIKey | BYVOGUFFWTUGCI-VAWYXSNFSA-N |
| XLogP | 1.86 |
| TPSA | 92.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.22 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[(E)-1H-imidazol-2-yldiazenyl]-1,3-thiazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-1H-imidazol-2-yldiazenyl]-1,3-thiazol-5-amine?
The IUPAC name of 2-[(E)-1H-imidazol-2-yldiazenyl]-1,3-thiazol-5-amine (CID 177404121) is 2-[(E)-1H-imidazol-2-yldiazenyl]-1,3-thiazol-5-amine.
What is the SMILES notation for 2-[(E)-1H-imidazol-2-yldiazenyl]-1,3-thiazol-5-amine?
The canonical SMILES for 2-[(E)-1H-imidazol-2-yldiazenyl]-1,3-thiazol-5-amine is Nc1cnc(/N=N/c2ncc[nH]2)s1.
What is the InChIKey of 2-[(E)-1H-imidazol-2-yldiazenyl]-1,3-thiazol-5-amine?
The InChIKey is BYVOGUFFWTUGCI-VAWYXSNFSA-N. The full InChI is InChI=1S/C6H6N6S/c7-4-3-10-6(13-4)12-11-5-8-1-2-9-5/h1-3H,7H2,(H,8,9)/b12-11+.
What are the key properties of 2-[(E)-1H-imidazol-2-yldiazenyl]-1,3-thiazol-5-amine?
2-[(E)-1H-imidazol-2-yldiazenyl]-1,3-thiazol-5-amine has a molecular weight of 194.22 g/mol, XLogP of 1.86, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-1H-imidazol-2-yldiazenyl]-1,3-thiazol-5-amine is sourced from PubChem (CID 177404121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).