C19H21NO5 — CID 177405445
[2-[[(E)-(2,6-dimethoxyphenyl)methylideneamino]oxymethyl]-3-methylphenyl] acetate (PubChem CID 177405445) has the molecular formula C19H21NO5 and a molecular weight of 343.38 g/mol. Its IUPAC name is [2-[[(E)-(2,6-dimethoxyphenyl)methylideneamino]oxymethyl]-3-methylphenyl] acetate.
| Compound Name | [2-[[(E)-(2,6-dimethoxyphenyl)methylideneamino]oxymethyl]-3-methylphenyl] acetate |
|---|---|
| PubChem CID | 177405445 |
| Molecular Formula | C19H21NO5 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | [2-[[(E)-(2,6-dimethoxyphenyl)methylideneamino]oxymethyl]-3-methylphenyl] acetate |
| SMILES | COc1cccc(OC)c1/C=N/OCc1c(C)cccc1OC(C)=O |
| InChI | InChI=1S/C19H21NO5/c1-13-7-5-10-19(25-14(2)21)16(13)12-24-20-11-15-17(22-3)8-6-9-18(15)23-4/h5-11H,12H2,1-4H3/b20-11+ |
| InChIKey | DIZDCDYTKCDDTB-RGVLZGJSSA-N |
| XLogP | 3.49 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|