C20H21NO5 — CID 177453131
[3-[(E)-(2,6-dimethoxyphenyl)methylideneamino]oxy-2,3-dihydro-1H-inden-4-yl] acetate (PubChem CID 177453131) has the molecular formula C20H21NO5 and a molecular weight of 355.39 g/mol. Its IUPAC name is [3-[(E)-(2,6-dimethoxyphenyl)methylideneamino]oxy-2,3-dihydro-1H-inden-4-yl] acetate.
| Compound Name | [3-[(E)-(2,6-dimethoxyphenyl)methylideneamino]oxy-2,3-dihydro-1H-inden-4-yl] acetate |
|---|---|
| PubChem CID | 177453131 |
| Molecular Formula | C20H21NO5 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | [3-[(E)-(2,6-dimethoxyphenyl)methylideneamino]oxy-2,3-dihydro-1H-inden-4-yl] acetate |
| SMILES | COc1cccc(OC)c1/C=N/OC1CCc2cccc(OC(C)=O)c21 |
| InChI | InChI=1S/C20H21NO5/c1-13(22)25-18-9-4-6-14-10-11-19(20(14)18)26-21-12-15-16(23-2)7-5-8-17(15)24-3/h4-9,12,19H,10-11H2,1-3H3/b21-12+ |
| InChIKey | BEMXNVVHHMQGEE-CIAFOILYSA-N |
| XLogP | 3.67 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|