C31H25NO4S — CID 177406664
(2'Z)-1'-(4-methylphenyl)sulfonyl-2'-(2-naphthalen-2-yl-2-oxoethylidene)spiro[3H-indene-2,3'-pyrrolidine]-1-one (PubChem CID 177406664) has the molecular formula C31H25NO4S and a molecular weight of 507.61 g/mol. Its IUPAC name is (2'Z)-1'-(4-methylphenyl)sulfonyl-2'-(2-naphthalen-2-yl-2-oxoethylidene)spiro[3H-indene-2,3'-pyrrolidine]-1-one.
| Compound Name | (2'Z)-1'-(4-methylphenyl)sulfonyl-2'-(2-naphthalen-2-yl-2-oxoethylidene)spiro[3H-indene-2,3'-pyrrolidine]-1-one |
|---|---|
| PubChem CID | 177406664 |
| Molecular Formula | C31H25NO4S |
| Molecular Weight | 507.61 g/mol |
| Exact Mass | 507.15 |
| IUPAC Name | (2'Z)-1'-(4-methylphenyl)sulfonyl-2'-(2-naphthalen-2-yl-2-oxoethylidene)spiro[3H-indene-2,3'-pyrrolidine]-1-one |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC3(Cc4ccccc4C3=O)/C2=C/C(=O)c2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C31H25NO4S/c1-21-10-14-26(15-11-21)37(35,36)32-17-16-31(20-25-8-4-5-9-27(25)30(31)34)29(32)19-28(33)24-13-12-22-6-2-3-7-23(22)18-24/h2-15,18-19H,16-17,20H2,1H3/b29-19- |
| InChIKey | BMSHYDQHDFVPMW-CEUNXORHSA-N |
| XLogP | 5.73 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.61 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|