C30H23NO4S — CID 132595480
4'-benzoyl-1'-(4-methylphenyl)sulfonylspiro[fluorene-9,3'-pyrrolidine]-2'-one (PubChem CID 132595480) has the molecular formula C30H23NO4S and a molecular weight of 493.58 g/mol. Its IUPAC name is 4'-benzoyl-1'-(4-methylphenyl)sulfonylspiro[fluorene-9,3'-pyrrolidine]-2'-one.
| Compound Name | 4'-benzoyl-1'-(4-methylphenyl)sulfonylspiro[fluorene-9,3'-pyrrolidine]-2'-one |
|---|---|
| PubChem CID | 132595480 |
| Molecular Formula | C30H23NO4S |
| Molecular Weight | 493.58 g/mol |
| Exact Mass | 493.13 |
| IUPAC Name | 4'-benzoyl-1'-(4-methylphenyl)sulfonylspiro[fluorene-9,3'-pyrrolidine]-2'-one |
| SMILES | Cc1ccc(S(=O)(=O)N2CC(C(=O)c3ccccc3)C3(C2=O)c2ccccc2-c2ccccc23)cc1 |
| InChI | InChI=1S/C30H23NO4S/c1-20-15-17-22(18-16-20)36(34,35)31-19-27(28(32)21-9-3-2-4-10-21)30(29(31)33)25-13-7-5-11-23(25)24-12-6-8-14-26(24)30/h2-18,27H,19H2,1H3 |
| InChIKey | PQSUDXWYVUEKIB-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.58 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |