C28H27NO3S — CID 139188654
(3R,3aR,7aR)-7a-methyl-1-(4-methylphenyl)sulfonyl-3-(1-naphthalen-2-ylethenyl)-2,3,3a,4-tetrahydroindol-5-one (PubChem CID 139188654) has the molecular formula C28H27NO3S and a molecular weight of 457.60 g/mol. Its IUPAC name is (3R,3aR,7aR)-7a-methyl-1-(4-methylphenyl)sulfonyl-3-(1-naphthalen-2-ylethenyl)-2,3,3a,4-tetrahydroindol-5-one.
| Compound Name | (3R,3aR,7aR)-7a-methyl-1-(4-methylphenyl)sulfonyl-3-(1-naphthalen-2-ylethenyl)-2,3,3a,4-tetrahydroindol-5-one |
|---|---|
| PubChem CID | 139188654 |
| Molecular Formula | C28H27NO3S |
| Molecular Weight | 457.60 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | (3R,3aR,7aR)-7a-methyl-1-(4-methylphenyl)sulfonyl-3-(1-naphthalen-2-ylethenyl)-2,3,3a,4-tetrahydroindol-5-one |
| SMILES | C=C(c1ccc2ccccc2c1)[C@@H]1CN(S(=O)(=O)c2ccc(C)cc2)[C@]2(C)C=CC(=O)C[C@H]12 |
| InChI | InChI=1S/C28H27NO3S/c1-19-8-12-25(13-9-19)33(31,32)29-18-26(27-17-24(30)14-15-28(27,29)3)20(2)22-11-10-21-6-4-5-7-23(21)16-22/h4-16,26-27H,2,17-18H2,1,3H3/t26-,27+,28+/m0/s1 |
| InChIKey | AIZCEYQEAFWSHR-UPRLRBBYSA-N |
| XLogP | 5.39 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.60 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |