C29H44O4 — CID 177407441
methyl (2S,3aR,3bS,5aR,6R,8aS,8bS)-6-[(2R,5R)-5,6-dimethylhept-3-en-2-yl]-2-hydroxy-3a,5a-dimethyl-1-oxo-3,3b,4,5,6,7,8,8a,8b,9-decahydroindeno[5,4-e]indene-2-carboxylate (PubChem CID 177407441) has the molecular formula C29H44O4 and a molecular weight of 456.67 g/mol. Its IUPAC name is methyl (2S,3aR,3bS,5aR,6R,8aS,8bS)-6-[(2R,5R)-5,6-dimethylhept-3-en-2-yl]-2-hydroxy-3a,5a-dimethyl-1-oxo-3,3b,4,5,6,7,8,8a,8b,9-decahydroindeno[5,4-e]indene-2-carboxylate.
| Compound Name | methyl (2S,3aR,3bS,5aR,6R,8aS,8bS)-6-[(2R,5R)-5,6-dimethylhept-3-en-2-yl]-2-hydroxy-3a,5a-dimethyl-1-oxo-3,3b,4,5,6,7,8,8a,8b,9-decahydroindeno[5,4-e]indene-2-carboxylate |
|---|---|
| PubChem CID | 177407441 |
| Molecular Formula | C29H44O4 |
| Molecular Weight | 456.67 g/mol |
| Exact Mass | 456.32 |
| IUPAC Name | methyl (2S,3aR,3bS,5aR,6R,8aS,8bS)-6-[(2R,5R)-5,6-dimethylhept-3-en-2-yl]-2-hydroxy-3a,5a-dimethyl-1-oxo-3,3b,4,5,6,7,8,8a,8b,9-decahydroindeno[5,4-e]indene-2-carboxylate |
| SMILES | COC(=O)[C@]1(O)C[C@@]2(C)C(=CC[C@H]3[C@@H]4CC[C@H]([C@H](C)C=C[C@H](C)C(C)C)[C@@]4(C)CC[C@@H]32)C1=O |
| InChI | InChI=1S/C29H44O4/c1-17(2)18(3)8-9-19(4)21-12-13-22-20-10-11-24-25(30)29(32,26(31)33-7)16-28(24,6)23(20)14-15-27(21,22)5/h8-9,11,17-23,32H,10,12-16H2,1-7H3/t18-,19+,20-,21+,22-,23-,27+,28+,29-/m0/s1 |
| InChIKey | ICVWSINXYBAOLU-PUAHIDSUSA-N |
| XLogP | 5.74 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.67 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|