C25H40O2 — CID 177408906
(2S)-2,7,8-trimethyl-5-methylidene-2-[(2R,4R)-2,4,8-trimethylnonyl]-3,4-dihydrochromen-6-one (PubChem CID 177408906) has the molecular formula C25H40O2 and a molecular weight of 372.59 g/mol. Its IUPAC name is (2S)-2,7,8-trimethyl-5-methylidene-2-[(2R,4R)-2,4,8-trimethylnonyl]-3,4-dihydrochromen-6-one.
| Compound Name | (2S)-2,7,8-trimethyl-5-methylidene-2-[(2R,4R)-2,4,8-trimethylnonyl]-3,4-dihydrochromen-6-one |
|---|---|
| PubChem CID | 177408906 |
| Molecular Formula | C25H40O2 |
| Molecular Weight | 372.59 g/mol |
| Exact Mass | 372.30 |
| IUPAC Name | (2S)-2,7,8-trimethyl-5-methylidene-2-[(2R,4R)-2,4,8-trimethylnonyl]-3,4-dihydrochromen-6-one |
| SMILES | C=C1C(=O)C(C)=C(C)C2=C1CC[C@@](C)(C[C@H](C)C[C@H](C)CCCC(C)C)O2 |
| InChI | InChI=1S/C25H40O2/c1-16(2)10-9-11-17(3)14-18(4)15-25(8)13-12-22-21(7)23(26)19(5)20(6)24(22)27-25/h16-18H,7,9-15H2,1-6,8H3/t17-,18-,25+/m1/s1 |
| InChIKey | YXBPYEPWQZCNNY-GAKIBJFNSA-N |
| XLogP | 7.16 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.59 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|