C44H38F4O2S6 — CID 177412736
2,2,5,5-tetrafluoro-3,6-bis[5-[5-(5-hexylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]pentalene-1,4-dione (PubChem CID 177412736) has the molecular formula C44H38F4O2S6 and a molecular weight of 867.18 g/mol. Its IUPAC name is 2,2,5,5-tetrafluoro-3,6-bis[5-[5-(5-hexylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]pentalene-1,4-dione.
| Compound Name | 2,2,5,5-tetrafluoro-3,6-bis[5-[5-(5-hexylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]pentalene-1,4-dione |
|---|---|
| PubChem CID | 177412736 |
| Molecular Formula | C44H38F4O2S6 |
| Molecular Weight | 867.18 g/mol |
| Exact Mass | 866.11 |
| IUPAC Name | 2,2,5,5-tetrafluoro-3,6-bis[5-[5-(5-hexylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]pentalene-1,4-dione |
| SMILES | CCCCCCc1ccc(-c2ccc(-c3ccc(C4=C5C(=O)C(F)(F)C(c6ccc(-c7ccc(-c8ccc(CCCCCC)s8)s7)s6)=C5C(=O)C4(F)F)s3)s2)s1 |
| InChI | InChI=1S/C44H38F4O2S6/c1-3-5-7-9-11-25-13-15-27(51-25)29-17-19-31(53-29)33-21-23-35(55-33)39-37-38(42(50)43(39,45)46)40(44(47,48)41(37)49)36-24-22-34(56-36)32-20-18-30(54-32)28-16-14-26(52-28)12-10-8-6-4-2/h13-24H,3-12H2,1-2H3 |
| InChIKey | BJBPXLDVXKBHGX-UHFFFAOYSA-N |
| XLogP | 15.61 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 867.18 |
| LogP ≤ 5 | 15.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|