C30H24N2O6S3 — CID 177414771
4,12-bis(3-methoxyphenyl)-8-(2-nitrophenyl)sulfonyl-3,13-dithia-8-azatricyclo[8.3.0.02,6]trideca-1(10),2(6),4,11-tetraene (PubChem CID 177414771) has the molecular formula C30H24N2O6S3 and a molecular weight of 604.73 g/mol. Its IUPAC name is 4,12-bis(3-methoxyphenyl)-8-(2-nitrophenyl)sulfonyl-3,13-dithia-8-azatricyclo[8.3.0.02,6]trideca-1(10),2(6),4,11-tetraene.
| Compound Name | 4,12-bis(3-methoxyphenyl)-8-(2-nitrophenyl)sulfonyl-3,13-dithia-8-azatricyclo[8.3.0.02,6]trideca-1(10),2(6),4,11-tetraene |
|---|---|
| PubChem CID | 177414771 |
| Molecular Formula | C30H24N2O6S3 |
| Molecular Weight | 604.73 g/mol |
| Exact Mass | 604.08 |
| IUPAC Name | 4,12-bis(3-methoxyphenyl)-8-(2-nitrophenyl)sulfonyl-3,13-dithia-8-azatricyclo[8.3.0.02,6]trideca-1(10),2(6),4,11-tetraene |
| SMILES | COc1cccc(-c2cc3c(s2)-c2sc(-c4cccc(OC)c4)cc2CN(S(=O)(=O)c2ccccc2[N+](=O)[O-])C3)c1 |
| InChI | InChI=1S/C30H24N2O6S3/c1-37-23-9-5-7-19(13-23)26-15-21-17-31(41(35,36)28-12-4-3-11-25(28)32(33)34)18-22-16-27(40-30(22)29(21)39-26)20-8-6-10-24(14-20)38-2/h3-16H,17-18H2,1-2H3 |
| InChIKey | LISZCQCOURSEQH-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.73 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|