C22H24BrF2NO3S — CID 177415564
(5-bromo-4,4-difluoropentyl) 2-[3-ethynyl-4-(2-methylpropoxy)phenyl]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 177415564) has the molecular formula C22H24BrF2NO3S and a molecular weight of 500.41 g/mol. Its IUPAC name is (5-bromo-4,4-difluoropentyl) 2-[3-ethynyl-4-(2-methylpropoxy)phenyl]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | (5-bromo-4,4-difluoropentyl) 2-[3-ethynyl-4-(2-methylpropoxy)phenyl]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 177415564 |
| Molecular Formula | C22H24BrF2NO3S |
| Molecular Weight | 500.41 g/mol |
| Exact Mass | 499.06 |
| IUPAC Name | (5-bromo-4,4-difluoropentyl) 2-[3-ethynyl-4-(2-methylpropoxy)phenyl]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | C#Cc1cc(-c2nc(C)c(C(=O)OCCCC(F)(F)CBr)s2)ccc1OCC(C)C |
| InChI | InChI=1S/C22H24BrF2NO3S/c1-5-16-11-17(7-8-18(16)29-12-14(2)3)20-26-15(4)19(30-20)21(27)28-10-6-9-22(24,25)13-23/h1,7-8,11,14H,6,9-10,12-13H2,2-4H3 |
| InChIKey | KWDIAQWMWWVIET-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.41 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|