C27H28O — CID 177417374
2-[1-(4-methoxyphenyl)pent-4-en-2-yl]-4-methyl-1-(1-phenylethenyl)benzene (PubChem CID 177417374) has the molecular formula C27H28O and a molecular weight of 368.52 g/mol. Its IUPAC name is 2-[1-(4-methoxyphenyl)pent-4-en-2-yl]-4-methyl-1-(1-phenylethenyl)benzene.
| Compound Name | 2-[1-(4-methoxyphenyl)pent-4-en-2-yl]-4-methyl-1-(1-phenylethenyl)benzene |
|---|---|
| PubChem CID | 177417374 |
| Molecular Formula | C27H28O |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | 2-[1-(4-methoxyphenyl)pent-4-en-2-yl]-4-methyl-1-(1-phenylethenyl)benzene |
| SMILES | C=CCC(Cc1ccc(OC)cc1)c1cc(C)ccc1C(=C)c1ccccc1 |
| InChI | InChI=1S/C27H28O/c1-5-9-24(19-22-13-15-25(28-4)16-14-22)27-18-20(2)12-17-26(27)21(3)23-10-7-6-8-11-23/h5-8,10-18,24H,1,3,9,19H2,2,4H3 |
| InChIKey | DQTCRGCBMZXCMY-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|