C20H23F17SiSn — CID 177417658
3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl-dimethyl-(1-trimethylstannylcyclopenta-2,4-dien-1-yl)silane (PubChem CID 177417658) has the molecular formula C20H23F17SiSn and a molecular weight of 733.17 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl-dimethyl-(1-trimethylstannylcyclopenta-2,4-dien-1-yl)silane.
| Compound Name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl-dimethyl-(1-trimethylstannylcyclopenta-2,4-dien-1-yl)silane |
|---|---|
| PubChem CID | 177417658 |
| Molecular Formula | C20H23F17SiSn |
| Molecular Weight | 733.17 g/mol |
| Exact Mass | 734.03 |
| IUPAC Name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl-dimethyl-(1-trimethylstannylcyclopenta-2,4-dien-1-yl)silane |
| SMILES | C[Si](C)(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C1([Sn](C)(C)C)C=CC=C1 |
| InChI | InChI=1S/C17H14F17Si.3CH3.Sn/c1-35(2,9-5-3-4-6-9)8-7-10(18,19)11(20,21)12(22,23)13(24,25)14(26,27)15(28,29)16(30,31)17(32,33)34;;;;/h3-6H,7-8H2,1-2H3;3*1H3; |
| InChIKey | RJDVPLLIWYATJZ-UHFFFAOYSA-N |
| XLogP | 9.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.17 |
| LogP ≤ 5 | 9.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|