C15H9NO6 — CID 177418726
(2E)-6-methyl-2-[(2-nitrophenyl)methylidene]furo[3,2-c]pyran-3,4-dione (PubChem CID 177418726) has the molecular formula C15H9NO6 and a molecular weight of 299.24 g/mol. Its IUPAC name is (2E)-6-methyl-2-[(2-nitrophenyl)methylidene]furo[3,2-c]pyran-3,4-dione.
| Compound Name | (2E)-6-methyl-2-[(2-nitrophenyl)methylidene]furo[3,2-c]pyran-3,4-dione |
|---|---|
| PubChem CID | 177418726 |
| Molecular Formula | C15H9NO6 |
| Molecular Weight | 299.24 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | (2E)-6-methyl-2-[(2-nitrophenyl)methylidene]furo[3,2-c]pyran-3,4-dione |
| SMILES | Cc1cc2c(c(=O)o1)C(=O)/C(=C\c1ccccc1[N+](=O)[O-])O2 |
| InChI | InChI=1S/C15H9NO6/c1-8-6-11-13(15(18)21-8)14(17)12(22-11)7-9-4-2-3-5-10(9)16(19)20/h2-7H,1H3/b12-7+ |
| InChIKey | UYSAHVFJUQEFCF-KPKJPENVSA-N |
| XLogP | 2.47 |
| TPSA | 99.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.24 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|