About (3Z)-3-[(2-nitrophenyl)methylidene]benzo[g][1,4]benzodioxine
(3Z)-3-[(2-nitrophenyl)methylidene]benzo[g][1,4]benzodioxine (PubChem CID 10639320) has the molecular formula C19H13NO4
and a molecular weight of 319.32 g/mol. Its IUPAC name is (3Z)-3-[(2-nitrophenyl)methylidene]benzo[g][1,4]benzodioxine.
Molecular Properties
| Compound Name | (3Z)-3-[(2-nitrophenyl)methylidene]benzo[g][1,4]benzodioxine |
| PubChem CID | 10639320 |
| Molecular Formula | C19H13NO4 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | (3Z)-3-[(2-nitrophenyl)methylidene]benzo[g][1,4]benzodioxine |
| SMILES | O=[N+]([O-])c1ccccc1/C=C1/COc2cc3ccccc3cc2O1 |
| InChI | InChI=1S/C19H13NO4/c21-20(22)17-8-4-3-7-15(17)9-16-12-23-18-10-13-5-1-2-6-14(13)11-19(18)24-16/h1-11H,12H2/b16-9- |
| InChIKey | ZUIMTKWOQMYUSX-SXGWCWSVSA-N |
| XLogP | 4.56 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-3-[(2-nitrophenyl)methylidene]benzo[g][1,4]benzodioxine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-3-[(2-nitrophenyl)methylidene]benzo[g][1,4]benzodioxine?
The IUPAC name of (3Z)-3-[(2-nitrophenyl)methylidene]benzo[g][1,4]benzodioxine (CID 10639320) is (3Z)-3-[(2-nitrophenyl)methylidene]benzo[g][1,4]benzodioxine.
What is the SMILES notation for (3Z)-3-[(2-nitrophenyl)methylidene]benzo[g][1,4]benzodioxine?
The canonical SMILES for (3Z)-3-[(2-nitrophenyl)methylidene]benzo[g][1,4]benzodioxine is O=[N+]([O-])c1ccccc1/C=C1/COc2cc3ccccc3cc2O1.
What is the InChIKey of (3Z)-3-[(2-nitrophenyl)methylidene]benzo[g][1,4]benzodioxine?
The InChIKey is ZUIMTKWOQMYUSX-SXGWCWSVSA-N. The full InChI is InChI=1S/C19H13NO4/c21-20(22)17-8-4-3-7-15(17)9-16-12-23-18-10-13-5-1-2-6-14(13)11-19(18)24-16/h1-11H,12H2/b16-9-.
What are the key properties of (3Z)-3-[(2-nitrophenyl)methylidene]benzo[g][1,4]benzodioxine?
(3Z)-3-[(2-nitrophenyl)methylidene]benzo[g][1,4]benzodioxine has a molecular weight of 319.32 g/mol, XLogP of 4.56, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-3-[(2-nitrophenyl)methylidene]benzo[g][1,4]benzodioxine is sourced from PubChem (CID 10639320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).