C8H7N3O4S — CID 117062520
(4E)-4-[(2-nitrophenyl)methylidene]-1,2,3,5-oxathiadiazolidine 2-oxide (PubChem CID 117062520) has the molecular formula C8H7N3O4S and a molecular weight of 241.23 g/mol. Its IUPAC name is (4E)-4-[(2-nitrophenyl)methylidene]-1,2,3,5-oxathiadiazolidine 2-oxide.
| Compound Name | (4E)-4-[(2-nitrophenyl)methylidene]-1,2,3,5-oxathiadiazolidine 2-oxide |
|---|---|
| PubChem CID | 117062520 |
| Molecular Formula | C8H7N3O4S |
| Molecular Weight | 241.23 g/mol |
| Exact Mass | 241.02 |
| IUPAC Name | (4E)-4-[(2-nitrophenyl)methylidene]-1,2,3,5-oxathiadiazolidine 2-oxide |
| SMILES | O=[N+]([O-])c1ccccc1/C=C1\NOS(=O)N1 |
| InChI | InChI=1S/C8H7N3O4S/c12-11(13)7-4-2-1-3-6(7)5-8-9-15-16(14)10-8/h1-5,9-10H/b8-5+ |
| InChIKey | NPPBMFBIQOFSLS-VMPITWQZSA-N |
| XLogP | 0.60 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.23 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|