C15H9ClO4 — CID 51350863
(2Z)-2-[(4-chlorophenyl)methylidene]-6-methylfuro[3,2-c]pyran-3,4-dione (PubChem CID 51350863) has the molecular formula C15H9ClO4 and a molecular weight of 288.69 g/mol. Its IUPAC name is (2Z)-2-[(4-chlorophenyl)methylidene]-6-methylfuro[3,2-c]pyran-3,4-dione.
| Compound Name | (2Z)-2-[(4-chlorophenyl)methylidene]-6-methylfuro[3,2-c]pyran-3,4-dione |
|---|---|
| PubChem CID | 51350863 |
| Molecular Formula | C15H9ClO4 |
| Molecular Weight | 288.69 g/mol |
| Exact Mass | 288.02 |
| IUPAC Name | (2Z)-2-[(4-chlorophenyl)methylidene]-6-methylfuro[3,2-c]pyran-3,4-dione |
| SMILES | Cc1cc2c(c(=O)o1)C(=O)/C(=C/c1ccc(Cl)cc1)O2 |
| InChI | InChI=1S/C15H9ClO4/c1-8-6-11-13(15(18)19-8)14(17)12(20-11)7-9-2-4-10(16)5-3-9/h2-7H,1H3/b12-7- |
| InChIKey | KEDJBHXUUFGUJX-GHXNOFRVSA-N |
| XLogP | 3.22 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.69 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|