C17H13ClO2 — CID 163322912
(2Z)-2-benzylidene-5-chloro-4,6-dimethyl-1-benzofuran-3-one (PubChem CID 163322912) has the molecular formula C17H13ClO2 and a molecular weight of 284.74 g/mol. Its IUPAC name is (2Z)-2-benzylidene-5-chloro-4,6-dimethyl-1-benzofuran-3-one.
| Compound Name | (2Z)-2-benzylidene-5-chloro-4,6-dimethyl-1-benzofuran-3-one |
|---|---|
| PubChem CID | 163322912 |
| Molecular Formula | C17H13ClO2 |
| Molecular Weight | 284.74 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | (2Z)-2-benzylidene-5-chloro-4,6-dimethyl-1-benzofuran-3-one |
| SMILES | Cc1cc2c(c(C)c1Cl)C(=O)/C(=C/c1ccccc1)O2 |
| InChI | InChI=1S/C17H13ClO2/c1-10-8-13-15(11(2)16(10)18)17(19)14(20-13)9-12-6-4-3-5-7-12/h3-9H,1-2H3/b14-9- |
| InChIKey | QAKKMLDDSDXEDK-ZROIWOOFSA-N |
| XLogP | 4.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.74 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|