C19H11ClO4 — CID 5390931
(8E)-8-[(4-chlorophenyl)methylidene]-4-methylfuro[2,3-h]chromene-2,9-dione (PubChem CID 5390931) has the molecular formula C19H11ClO4 and a molecular weight of 338.75 g/mol. Its IUPAC name is (8E)-8-[(4-chlorophenyl)methylidene]-4-methylfuro[2,3-h]chromene-2,9-dione.
| Compound Name | (8E)-8-[(4-chlorophenyl)methylidene]-4-methylfuro[2,3-h]chromene-2,9-dione |
|---|---|
| PubChem CID | 5390931 |
| Molecular Formula | C19H11ClO4 |
| Molecular Weight | 338.75 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | (8E)-8-[(4-chlorophenyl)methylidene]-4-methylfuro[2,3-h]chromene-2,9-dione |
| SMILES | Cc1cc(=O)oc2c3c(ccc12)O/C(=C/c1ccc(Cl)cc1)C3=O |
| InChI | InChI=1S/C19H11ClO4/c1-10-8-16(21)24-19-13(10)6-7-14-17(19)18(22)15(23-14)9-11-2-4-12(20)5-3-11/h2-9H,1H3/b15-9+ |
| InChIKey | OQKGPPKDCIFOLR-OQLLNIDSSA-N |
| XLogP | 4.37 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.75 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|