C21H14O6 — CID 629346
[4-[(4-methyl-2,9-dioxofuro[2,3-h]chromen-8-ylidene)methyl]phenyl] acetate (PubChem CID 629346) has the molecular formula C21H14O6 and a molecular weight of 362.34 g/mol. Its IUPAC name is [4-[(4-methyl-2,9-dioxofuro[2,3-h]chromen-8-ylidene)methyl]phenyl] acetate.
| Compound Name | [4-[(4-methyl-2,9-dioxofuro[2,3-h]chromen-8-ylidene)methyl]phenyl] acetate |
|---|---|
| PubChem CID | 629346 |
| Molecular Formula | C21H14O6 |
| Molecular Weight | 362.34 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | [4-[(4-methyl-2,9-dioxofuro[2,3-h]chromen-8-ylidene)methyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C=C2Oc3ccc4c(C)cc(=O)oc4c3C2=O)cc1 |
| InChI | InChI=1S/C21H14O6/c1-11-9-18(23)27-21-15(11)7-8-16-19(21)20(24)17(26-16)10-13-3-5-14(6-4-13)25-12(2)22/h3-10H,1-2H3 |
| InChIKey | WUOJTLTXOANKDV-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 82.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.34 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|