About 2-[(4-chlorophenyl)methylidene]-4,6-bis(methoxymethoxy)-5,7-dimethyl-1-benzofuran-3-one
2-[(4-chlorophenyl)methylidene]-4,6-bis(methoxymethoxy)-5,7-dimethyl-1-benzofuran-3-one (PubChem CID 75953781) has the molecular formula C21H21ClO6
and a molecular weight of 404.85 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methylidene]-4,6-bis(methoxymethoxy)-5,7-dimethyl-1-benzofuran-3-one.
Molecular Properties
| Compound Name | 2-[(4-chlorophenyl)methylidene]-4,6-bis(methoxymethoxy)-5,7-dimethyl-1-benzofuran-3-one |
| PubChem CID | 75953781 |
| Molecular Formula | C21H21ClO6 |
| Molecular Weight | 404.85 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | 2-[(4-chlorophenyl)methylidene]-4,6-bis(methoxymethoxy)-5,7-dimethyl-1-benzofuran-3-one |
| SMILES | COCOc1c(C)c(OCOC)c2c(c1C)OC(=Cc1ccc(Cl)cc1)C2=O |
| InChI | InChI=1S/C21H21ClO6/c1-12-19(26-10-24-3)13(2)21-17(20(12)27-11-25-4)18(23)16(28-21)9-14-5-7-15(22)8-6-14/h5-9H,10-11H2,1-4H3 |
| InChIKey | BVJHJQIPKMUXBB-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.85 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[(4-chlorophenyl)methylidene]-4,6-bis(methoxymethoxy)-5,7-dimethyl-1-benzofuran-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-chlorophenyl)methylidene]-4,6-bis(methoxymethoxy)-5,7-dimethyl-1-benzofuran-3-one?
The IUPAC name of 2-[(4-chlorophenyl)methylidene]-4,6-bis(methoxymethoxy)-5,7-dimethyl-1-benzofuran-3-one (CID 75953781) is 2-[(4-chlorophenyl)methylidene]-4,6-bis(methoxymethoxy)-5,7-dimethyl-1-benzofuran-3-one.
What is the SMILES notation for 2-[(4-chlorophenyl)methylidene]-4,6-bis(methoxymethoxy)-5,7-dimethyl-1-benzofuran-3-one?
The canonical SMILES for 2-[(4-chlorophenyl)methylidene]-4,6-bis(methoxymethoxy)-5,7-dimethyl-1-benzofuran-3-one is COCOc1c(C)c(OCOC)c2c(c1C)OC(=Cc1ccc(Cl)cc1)C2=O.
What is the InChIKey of 2-[(4-chlorophenyl)methylidene]-4,6-bis(methoxymethoxy)-5,7-dimethyl-1-benzofuran-3-one?
The InChIKey is BVJHJQIPKMUXBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21ClO6/c1-12-19(26-10-24-3)13(2)21-17(20(12)27-11-25-4)18(23)16(28-21)9-14-5-7-15(22)8-6-14/h5-9H,10-11H2,1-4H3.
What are the key properties of 2-[(4-chlorophenyl)methylidene]-4,6-bis(methoxymethoxy)-5,7-dimethyl-1-benzofuran-3-one?
2-[(4-chlorophenyl)methylidene]-4,6-bis(methoxymethoxy)-5,7-dimethyl-1-benzofuran-3-one has a molecular weight of 404.85 g/mol, XLogP of 4.54, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-chlorophenyl)methylidene]-4,6-bis(methoxymethoxy)-5,7-dimethyl-1-benzofuran-3-one is sourced from PubChem (CID 75953781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).