C21H21ClO6 — CID 75953781
2-[(4-chlorophenyl)methylidene]-4,6-bis(methoxymethoxy)-5,7-dimethyl-1-benzofuran-3-one (PubChem CID 75953781) has the molecular formula C21H21ClO6 and a molecular weight of 404.85 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methylidene]-4,6-bis(methoxymethoxy)-5,7-dimethyl-1-benzofuran-3-one.
| Compound Name | 2-[(4-chlorophenyl)methylidene]-4,6-bis(methoxymethoxy)-5,7-dimethyl-1-benzofuran-3-one |
|---|---|
| PubChem CID | 75953781 |
| Molecular Formula | C21H21ClO6 |
| Molecular Weight | 404.85 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | 2-[(4-chlorophenyl)methylidene]-4,6-bis(methoxymethoxy)-5,7-dimethyl-1-benzofuran-3-one |
| SMILES | COCOc1c(C)c(OCOC)c2c(c1C)OC(=Cc1ccc(Cl)cc1)C2=O |
| InChI | InChI=1S/C21H21ClO6/c1-12-19(26-10-24-3)13(2)21-17(20(12)27-11-25-4)18(23)16(28-21)9-14-5-7-15(22)8-6-14/h5-9H,10-11H2,1-4H3 |
| InChIKey | BVJHJQIPKMUXBB-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.85 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|