C38H48N6O6Si — CID 177421483
benzyl (3S)-2-[(2S)-3-azido-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoyl]-3-[[tert-butyl(dimethyl)silyl]oxymethyl]diazinane-1-carboxylate (PubChem CID 177421483) has the molecular formula C38H48N6O6Si and a molecular weight of 712.92 g/mol. Its IUPAC name is benzyl (3S)-2-[(2S)-3-azido-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoyl]-3-[[tert-butyl(dimethyl)silyl]oxymethyl]diazinane-1-carboxylate.
| Compound Name | benzyl (3S)-2-[(2S)-3-azido-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoyl]-3-[[tert-butyl(dimethyl)silyl]oxymethyl]diazinane-1-carboxylate |
|---|---|
| PubChem CID | 177421483 |
| Molecular Formula | C38H48N6O6Si |
| Molecular Weight | 712.92 g/mol |
| Exact Mass | 712.34 |
| IUPAC Name | benzyl (3S)-2-[(2S)-3-azido-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoyl]-3-[[tert-butyl(dimethyl)silyl]oxymethyl]diazinane-1-carboxylate |
| SMILES | CC(N=[N+]=[N-])[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)N1[C@H](CO[Si](C)(C)C(C)(C)C)CCCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C38H48N6O6Si/c1-26(41-42-39)34(40-36(46)48-25-33-31-20-12-10-18-29(31)30-19-11-13-21-32(30)33)35(45)44-28(24-50-51(5,6)38(2,3)4)17-14-22-43(44)37(47)49-23-27-15-8-7-9-16-27/h7-13,15-16,18-21,26,28,33-34H,14,17,22-25H2,1-6H3,(H,40,46)/t26?,28-,34-/m0/s1 |
| InChIKey | GUXGABSOXFSIPK-YFIANVGPSA-N |
| XLogP | 8.16 |
| TPSA | 146.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.92 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|