C18H28N2O7 — CID 177421869
13-O-tert-butyl 9-O-methyl (1S,4Z,9S,12S)-11-oxo-2,7-dioxa-10,13-diazabicyclo[10.2.1]pentadec-4-ene-9,13-dicarboxylate (PubChem CID 177421869) has the molecular formula C18H28N2O7 and a molecular weight of 384.43 g/mol. Its IUPAC name is 13-O-tert-butyl 9-O-methyl (1S,4Z,9S,12S)-11-oxo-2,7-dioxa-10,13-diazabicyclo[10.2.1]pentadec-4-ene-9,13-dicarboxylate.
| Compound Name | 13-O-tert-butyl 9-O-methyl (1S,4Z,9S,12S)-11-oxo-2,7-dioxa-10,13-diazabicyclo[10.2.1]pentadec-4-ene-9,13-dicarboxylate |
|---|---|
| PubChem CID | 177421869 |
| Molecular Formula | C18H28N2O7 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | 13-O-tert-butyl 9-O-methyl (1S,4Z,9S,12S)-11-oxo-2,7-dioxa-10,13-diazabicyclo[10.2.1]pentadec-4-ene-9,13-dicarboxylate |
| SMILES | COC(=O)[C@@H]1COC/C=C\CO[C@H]2C[C@@H](C(=O)N1)N(C(=O)OC(C)(C)C)C2 |
| InChI | InChI=1S/C18H28N2O7/c1-18(2,3)27-17(23)20-10-12-9-14(20)15(21)19-13(16(22)24-4)11-25-7-5-6-8-26-12/h5-6,12-14H,7-11H2,1-4H3,(H,19,21)/b6-5-/t12-,13-,14-/m0/s1 |
| InChIKey | GYSSYKJYSVPPQX-MGFMJIJDSA-N |
| XLogP | 0.63 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|