C40H46N2O2P2Si2 — CID 177425210
2-[(1E)-4,4-bis[diphenyl(trimethylsilylimino)-λ5-phosphanyl]-3-hydroxybuta-1,3-dienyl]phenol (PubChem CID 177425210) has the molecular formula C40H46N2O2P2Si2 and a molecular weight of 704.94 g/mol. Its IUPAC name is 2-[(1E)-4,4-bis[diphenyl(trimethylsilylimino)-λ5-phosphanyl]-3-hydroxybuta-1,3-dienyl]phenol.
| Compound Name | 2-[(1E)-4,4-bis[diphenyl(trimethylsilylimino)-λ5-phosphanyl]-3-hydroxybuta-1,3-dienyl]phenol |
|---|---|
| PubChem CID | 177425210 |
| Molecular Formula | C40H46N2O2P2Si2 |
| Molecular Weight | 704.94 g/mol |
| Exact Mass | 704.26 |
| IUPAC Name | 2-[(1E)-4,4-bis[diphenyl(trimethylsilylimino)-λ5-phosphanyl]-3-hydroxybuta-1,3-dienyl]phenol |
| SMILES | C[Si](C)(C)N=P(C(=C(O)/C=C/c1ccccc1O)P(=N[Si](C)(C)C)(c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C40H46N2O2P2Si2/c1-47(2,3)41-45(34-22-11-7-12-23-34,35-24-13-8-14-25-35)40(39(44)32-31-33-21-19-20-30-38(33)43)46(42-48(4,5)6,36-26-15-9-16-27-36)37-28-17-10-18-29-37/h7-32,43-44H,1-6H3/b32-31+ |
| InChIKey | XQRJKXQNJLZBNS-QNEJGDQOSA-N |
| XLogP | 10.51 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.94 |
| LogP ≤ 5 | 10.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|