C9H13N3S+2 — CID 177425437
3-[2-(3-methylimidazol-3-ium-1-yl)ethyl]-1,3-thiazol-3-ium (PubChem CID 177425437) has the molecular formula C9H13N3S+2 and a molecular weight of 195.29 g/mol. Its IUPAC name is 3-[2-(3-methylimidazol-3-ium-1-yl)ethyl]-1,3-thiazol-3-ium.
| Compound Name | 3-[2-(3-methylimidazol-3-ium-1-yl)ethyl]-1,3-thiazol-3-ium |
|---|---|
| PubChem CID | 177425437 |
| Molecular Formula | C9H13N3S+2 |
| Molecular Weight | 195.29 g/mol |
| Exact Mass | 195.08 |
| IUPAC Name | 3-[2-(3-methylimidazol-3-ium-1-yl)ethyl]-1,3-thiazol-3-ium |
| SMILES | C[n+]1ccn(CC[n+]2ccsc2)c1 |
| InChI | InChI=1S/C9H13N3S/c1-10-2-3-11(8-10)4-5-12-6-7-13-9-12/h2-3,6-9H,4-5H2,1H3/q+2 |
| InChIKey | ZKWYWMCTLVCGKZ-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 12.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.29 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|