[(3R,5S)-4-ethyl-1-adamantyl] nitrate

C12H19NO3 — CID 177428268

IUPAC[(3R,5S)-4-ethyl-1-adamantyl] nitrate
SMILESCCC1[C@@H]2CC3C[C@H]1CC(O[N+](=O)[O-])(C3)C2
InChIInChI=1S/C12H19NO3/c1-2-11-9-3-8-4-10(11)7-12(5-8,6-9)16-13(14)15/h8-11H,2-7H2,1H3/t8?,9-,10+,11?,12?
InChIKeyNMQVEGFDFRUACH-KTMJHZKESA-N
MW225.29 g/mol
LogP2.80
Rot. Bonds3

About [(3R,5S)-4-ethyl-1-adamantyl] nitrate

[(3R,5S)-4-ethyl-1-adamantyl] nitrate (PubChem CID 177428268) has the molecular formula C12H19NO3 and a molecular weight of 225.29 g/mol. Its IUPAC name is [(3R,5S)-4-ethyl-1-adamantyl] nitrate.

Molecular Properties

Compound Name[(3R,5S)-4-ethyl-1-adamantyl] nitrate
PubChem CID177428268
Molecular FormulaC12H19NO3
Molecular Weight225.29 g/mol
Exact Mass225.14
IUPAC Name[(3R,5S)-4-ethyl-1-adamantyl] nitrate
SMILESCCC1[C@@H]2CC3C[C@H]1CC(O[N+](=O)[O-])(C3)C2
InChIInChI=1S/C12H19NO3/c1-2-11-9-3-8-4-10(11)7-12(5-8,6-9)16-13(14)15/h8-11H,2-7H2,1H3/t8?,9-,10+,11?,12?
InChIKeyNMQVEGFDFRUACH-KTMJHZKESA-N
XLogP2.80
TPSA52.37 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500225.29
LogP ≤ 52.80
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze [(3R,5S)-4-ethyl-1-adamantyl] nitrate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [(3R,5S)-4-ethyl-1-adamantyl] nitrate?
The IUPAC name of [(3R,5S)-4-ethyl-1-adamantyl] nitrate (CID 177428268) is [(3R,5S)-4-ethyl-1-adamantyl] nitrate.
What is the SMILES notation for [(3R,5S)-4-ethyl-1-adamantyl] nitrate?
The canonical SMILES for [(3R,5S)-4-ethyl-1-adamantyl] nitrate is CCC1[C@@H]2CC3C[C@H]1CC(O[N+](=O)[O-])(C3)C2.
What is the InChIKey of [(3R,5S)-4-ethyl-1-adamantyl] nitrate?
The InChIKey is NMQVEGFDFRUACH-KTMJHZKESA-N. The full InChI is InChI=1S/C12H19NO3/c1-2-11-9-3-8-4-10(11)7-12(5-8,6-9)16-13(14)15/h8-11H,2-7H2,1H3/t8?,9-,10+,11?,12?.
What are the key properties of [(3R,5S)-4-ethyl-1-adamantyl] nitrate?
[(3R,5S)-4-ethyl-1-adamantyl] nitrate has a molecular weight of 225.29 g/mol, XLogP of 2.80, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,5S)-4-ethyl-1-adamantyl] nitrate is sourced from PubChem (CID 177428268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).