C12H19NO3 — CID 177428268
[(3R,5S)-4-ethyl-1-adamantyl] nitrate (PubChem CID 177428268) has the molecular formula C12H19NO3 and a molecular weight of 225.29 g/mol. Its IUPAC name is [(3R,5S)-4-ethyl-1-adamantyl] nitrate.
| Compound Name | [(3R,5S)-4-ethyl-1-adamantyl] nitrate |
|---|---|
| PubChem CID | 177428268 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | [(3R,5S)-4-ethyl-1-adamantyl] nitrate |
| SMILES | CCC1[C@@H]2CC3C[C@H]1CC(O[N+](=O)[O-])(C3)C2 |
| InChI | InChI=1S/C12H19NO3/c1-2-11-9-3-8-4-10(11)7-12(5-8,6-9)16-13(14)15/h8-11H,2-7H2,1H3/t8?,9-,10+,11?,12? |
| InChIKey | NMQVEGFDFRUACH-KTMJHZKESA-N |
| XLogP | 2.80 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|