About (5-propoxy-2-adamantyl) N-[(E)-4-aminobut-2-enyl]carbamate
(5-propoxy-2-adamantyl) N-[(E)-4-aminobut-2-enyl]carbamate (PubChem CID 156899541) has the molecular formula C18H30N2O3
and a molecular weight of 322.45 g/mol. Its IUPAC name is (5-propoxy-2-adamantyl) N-[(E)-4-aminobut-2-enyl]carbamate.
Molecular Properties
| Compound Name | (5-propoxy-2-adamantyl) N-[(E)-4-aminobut-2-enyl]carbamate |
| PubChem CID | 156899541 |
| Molecular Formula | C18H30N2O3 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | (5-propoxy-2-adamantyl) N-[(E)-4-aminobut-2-enyl]carbamate |
| SMILES | CCCOC12CC3CC(C1)C(OC(=O)NC/C=C/CN)C(C3)C2 |
| InChI | InChI=1S/C18H30N2O3/c1-2-7-22-18-10-13-8-14(11-18)16(15(9-13)12-18)23-17(21)20-6-4-3-5-19/h3-4,13-16H,2,5-12,19H2,1H3,(H,20,21)/b4-3+ |
| InChIKey | MJSSXYXBZZIDES-ONEGZZNKSA-N |
| XLogP | 2.60 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (5-propoxy-2-adamantyl) N-[(E)-4-aminobut-2-enyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-propoxy-2-adamantyl) N-[(E)-4-aminobut-2-enyl]carbamate?
The IUPAC name of (5-propoxy-2-adamantyl) N-[(E)-4-aminobut-2-enyl]carbamate (CID 156899541) is (5-propoxy-2-adamantyl) N-[(E)-4-aminobut-2-enyl]carbamate.
What is the SMILES notation for (5-propoxy-2-adamantyl) N-[(E)-4-aminobut-2-enyl]carbamate?
The canonical SMILES for (5-propoxy-2-adamantyl) N-[(E)-4-aminobut-2-enyl]carbamate is CCCOC12CC3CC(C1)C(OC(=O)NC/C=C/CN)C(C3)C2.
What is the InChIKey of (5-propoxy-2-adamantyl) N-[(E)-4-aminobut-2-enyl]carbamate?
The InChIKey is MJSSXYXBZZIDES-ONEGZZNKSA-N. The full InChI is InChI=1S/C18H30N2O3/c1-2-7-22-18-10-13-8-14(11-18)16(15(9-13)12-18)23-17(21)20-6-4-3-5-19/h3-4,13-16H,2,5-12,19H2,1H3,(H,20,21)/b4-3+.
What are the key properties of (5-propoxy-2-adamantyl) N-[(E)-4-aminobut-2-enyl]carbamate?
(5-propoxy-2-adamantyl) N-[(E)-4-aminobut-2-enyl]carbamate has a molecular weight of 322.45 g/mol, XLogP of 2.60, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-propoxy-2-adamantyl) N-[(E)-4-aminobut-2-enyl]carbamate is sourced from PubChem (CID 156899541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).