C17H26F2O3 — CID 58225785
2,2-difluoroethyl 5-butoxyadamantane-2-carboxylate (PubChem CID 58225785) has the molecular formula C17H26F2O3 and a molecular weight of 316.39 g/mol. Its IUPAC name is 2,2-difluoroethyl 5-butoxyadamantane-2-carboxylate.
| Compound Name | 2,2-difluoroethyl 5-butoxyadamantane-2-carboxylate |
|---|---|
| PubChem CID | 58225785 |
| Molecular Formula | C17H26F2O3 |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | 2,2-difluoroethyl 5-butoxyadamantane-2-carboxylate |
| SMILES | CCCCOC12CC3CC(C1)C(C(=O)OCC(F)F)C(C3)C2 |
| InChI | InChI=1S/C17H26F2O3/c1-2-3-4-22-17-7-11-5-12(8-17)15(13(6-11)9-17)16(20)21-10-14(18)19/h11-15H,2-10H2,1H3 |
| InChIKey | ZTGLNRISTIQPNU-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|