C23H18N4O4 — CID 177428719
(2Z,3S,4S)-4-benzamido-2-[(3-nitrophenyl)methylidene]-3-phenyl-3,4-dihydropyrazol-2-ium-5-olate (PubChem CID 177428719) has the molecular formula C23H18N4O4 and a molecular weight of 414.42 g/mol. Its IUPAC name is (2Z,3S,4S)-4-benzamido-2-[(3-nitrophenyl)methylidene]-3-phenyl-3,4-dihydropyrazol-2-ium-5-olate.
| Compound Name | (2Z,3S,4S)-4-benzamido-2-[(3-nitrophenyl)methylidene]-3-phenyl-3,4-dihydropyrazol-2-ium-5-olate |
|---|---|
| PubChem CID | 177428719 |
| Molecular Formula | C23H18N4O4 |
| Molecular Weight | 414.42 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | (2Z,3S,4S)-4-benzamido-2-[(3-nitrophenyl)methylidene]-3-phenyl-3,4-dihydropyrazol-2-ium-5-olate |
| SMILES | O=C(N[C@@H]1C([O-])=N/[N+](=C\c2cccc([N+](=O)[O-])c2)[C@H]1c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H18N4O4/c28-22(18-11-5-2-6-12-18)24-20-21(17-9-3-1-4-10-17)26(25-23(20)29)15-16-8-7-13-19(14-16)27(30)31/h1-15,20-21H,(H-,24,25,28,29)/b26-15-/t20-,21-/m0/s1 |
| InChIKey | NOPDDJBWYWKKQB-LTXUPPABSA-N |
| XLogP | 2.25 |
| TPSA | 110.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.42 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|