C30H29N3O — CID 177428931
(2E)-2-(3,4-dihydro-2H-pyrrol-5-yl)-2-[(5S)-5-(trityloxymethyl)pyrrolidin-2-ylidene]acetonitrile (PubChem CID 177428931) has the molecular formula C30H29N3O and a molecular weight of 447.58 g/mol. Its IUPAC name is (2E)-2-(3,4-dihydro-2H-pyrrol-5-yl)-2-[(5S)-5-(trityloxymethyl)pyrrolidin-2-ylidene]acetonitrile.
| Compound Name | (2E)-2-(3,4-dihydro-2H-pyrrol-5-yl)-2-[(5S)-5-(trityloxymethyl)pyrrolidin-2-ylidene]acetonitrile |
|---|---|
| PubChem CID | 177428931 |
| Molecular Formula | C30H29N3O |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | (2E)-2-(3,4-dihydro-2H-pyrrol-5-yl)-2-[(5S)-5-(trityloxymethyl)pyrrolidin-2-ylidene]acetonitrile |
| SMILES | N#C/C(C1=NCCC1)=C1\CC[C@@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)N1 |
| InChI | InChI=1S/C30H29N3O/c31-21-27(28-17-10-20-32-28)29-19-18-26(33-29)22-34-30(23-11-4-1-5-12-23,24-13-6-2-7-14-24)25-15-8-3-9-16-25/h1-9,11-16,26,33H,10,17-20,22H2/b29-27-/t26-/m0/s1 |
| InChIKey | LQLLFCSNOFTNNA-CTOGLKSTSA-N |
| XLogP | 5.76 |
| TPSA | 57.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|