C30H36O5 — CID 177431647
2-[[(5Z)-5-[hydroxy(phenyl)methylidene]-2-methoxy-1,3-bis(3-methylbut-2-enyl)-4,6-dioxocyclohex-2-en-1-yl]methyl]-3-methylbut-2-enal (PubChem CID 177431647) has the molecular formula C30H36O5 and a molecular weight of 476.61 g/mol. Its IUPAC name is 2-[[(5Z)-5-[hydroxy(phenyl)methylidene]-2-methoxy-1,3-bis(3-methylbut-2-enyl)-4,6-dioxocyclohex-2-en-1-yl]methyl]-3-methylbut-2-enal.
| Compound Name | 2-[[(5Z)-5-[hydroxy(phenyl)methylidene]-2-methoxy-1,3-bis(3-methylbut-2-enyl)-4,6-dioxocyclohex-2-en-1-yl]methyl]-3-methylbut-2-enal |
|---|---|
| PubChem CID | 177431647 |
| Molecular Formula | C30H36O5 |
| Molecular Weight | 476.61 g/mol |
| Exact Mass | 476.26 |
| IUPAC Name | 2-[[(5Z)-5-[hydroxy(phenyl)methylidene]-2-methoxy-1,3-bis(3-methylbut-2-enyl)-4,6-dioxocyclohex-2-en-1-yl]methyl]-3-methylbut-2-enal |
| SMILES | COC1=C(CC=C(C)C)C(=O)/C(=C(/O)c2ccccc2)C(=O)C1(CC=C(C)C)CC(C=O)=C(C)C |
| InChI | InChI=1S/C30H36O5/c1-19(2)13-14-24-27(33)25(26(32)22-11-9-8-10-12-22)28(34)30(29(24)35-7,16-15-20(3)4)17-23(18-31)21(5)6/h8-13,15,18,32H,14,16-17H2,1-7H3/b26-25- |
| InChIKey | UKIHVXXCVJFYGS-QPLCGJKRSA-N |
| XLogP | 6.63 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.61 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|