C28H31NO4 — CID 75307858
7-benzoyl-6-methoxy-1,5-bis(3-methylbut-2-enyl)-8,9-dioxobicyclo[3.3.1]non-6-ene-3-carbonitrile (PubChem CID 75307858) has the molecular formula C28H31NO4 and a molecular weight of 445.56 g/mol. Its IUPAC name is 7-benzoyl-6-methoxy-1,5-bis(3-methylbut-2-enyl)-8,9-dioxobicyclo[3.3.1]non-6-ene-3-carbonitrile.
| Compound Name | 7-benzoyl-6-methoxy-1,5-bis(3-methylbut-2-enyl)-8,9-dioxobicyclo[3.3.1]non-6-ene-3-carbonitrile |
|---|---|
| PubChem CID | 75307858 |
| Molecular Formula | C28H31NO4 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | 7-benzoyl-6-methoxy-1,5-bis(3-methylbut-2-enyl)-8,9-dioxobicyclo[3.3.1]non-6-ene-3-carbonitrile |
| SMILES | COC1=C(C(=O)c2ccccc2)C(=O)C2(CC=C(C)C)CC(C#N)CC1(CC=C(C)C)C2=O |
| InChI | InChI=1S/C28H31NO4/c1-18(2)11-13-27-15-20(17-29)16-28(26(27)32,14-12-19(3)4)25(33-5)22(24(27)31)23(30)21-9-7-6-8-10-21/h6-12,20H,13-16H2,1-5H3 |
| InChIKey | ZSYVZVPIQZNCLP-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 84.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|