C45H66NNa — CID 177432652
sodium 2,2,6,6-tetrakis(1-adamantyl)piperidin-1-ide (PubChem CID 177432652) has the molecular formula C45H66NNa and a molecular weight of 644.02 g/mol. Its IUPAC name is sodium 2,2,6,6-tetrakis(1-adamantyl)piperidin-1-ide.
| Compound Name | sodium 2,2,6,6-tetrakis(1-adamantyl)piperidin-1-ide |
|---|---|
| PubChem CID | 177432652 |
| Molecular Formula | C45H66NNa |
| Molecular Weight | 644.02 g/mol |
| Exact Mass | 643.51 |
| IUPAC Name | sodium 2,2,6,6-tetrakis(1-adamantyl)piperidin-1-ide |
| SMILES | C1CC(C23CC4CC(CC(C4)C2)C3)(C23CC4CC(CC(C4)C2)C3)[N-]C(C23CC4CC(CC(C4)C2)C3)(C23CC4CC(CC(C4)C2)C3)C1.[Na+] |
| InChI | InChI=1S/C45H66N.Na/c1-2-44(40-16-28-4-29(17-40)6-30(5-28)18-40,41-19-31-7-32(20-41)9-33(8-31)21-41)46-45(3-1,42-22-34-10-35(23-42)12-36(11-34)24-42)43-25-37-13-38(26-43)15-39(14-37)27-43;/h28-39H,1-27H2;/q-1;+1 |
| InChIKey | BJGPMQLTWRGUSH-UHFFFAOYSA-N |
| XLogP | 8.89 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.02 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |