C45H67N — CID 177432653
2,2,6,6-tetrakis(1-adamantyl)piperidine (PubChem CID 177432653) has the molecular formula C45H67N and a molecular weight of 622.04 g/mol. Its IUPAC name is 2,2,6,6-tetrakis(1-adamantyl)piperidine.
| Compound Name | 2,2,6,6-tetrakis(1-adamantyl)piperidine |
|---|---|
| PubChem CID | 177432653 |
| Molecular Formula | C45H67N |
| Molecular Weight | 622.04 g/mol |
| Exact Mass | 621.53 |
| IUPAC Name | 2,2,6,6-tetrakis(1-adamantyl)piperidine |
| SMILES | C1CC(C23CC4CC(CC(C4)C2)C3)(C23CC4CC(CC(C4)C2)C3)NC(C23CC4CC(CC(C4)C2)C3)(C23CC4CC(CC(C4)C2)C3)C1 |
| InChI | InChI=1S/C45H67N/c1-2-44(40-16-28-4-29(17-40)6-30(5-28)18-40,41-19-31-7-32(20-41)9-33(8-31)21-41)46-45(3-1,42-22-34-10-35(23-42)12-36(11-34)24-42)43-25-37-13-38(26-43)15-39(14-37)27-43/h28-39,46H,1-27H2 |
| InChIKey | MGUDAVCXLLOZGS-UHFFFAOYSA-N |
| XLogP | 11.10 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.04 |
| LogP ≤ 5 | 11.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |