About CID 173482593
CID 173482593 (PubChem CID 173482593) has the molecular formula C21H33B
and a molecular weight of 296.31 g/mol.
Molecular Properties
| Compound Name | CID 173482593 |
| PubChem CID | 173482593 |
| Molecular Formula | C21H33B |
| Molecular Weight | 296.31 g/mol |
| Exact Mass | 296.27 |
| IUPAC Name | — |
| SMILES | [B]C1(CC)CC2CCCC(C34CC5CC(CC(C5)C3)C4)(C2)C1 |
| InChI | InChI=1S/C21H33B/c1-2-21(22)13-15-4-3-5-19(9-15,14-21)20-10-16-6-17(11-20)8-18(7-16)12-20/h15-18H,2-14H2,1H3 |
| InChIKey | ATAGULKTMAIPOO-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 296.31 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 173482593 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173482593?
The IUPAC name of CID 173482593 (CID 173482593) is not available.
What is the SMILES notation for CID 173482593?
The canonical SMILES for CID 173482593 is [B]C1(CC)CC2CCCC(C34CC5CC(CC(C5)C3)C4)(C2)C1.
What is the InChIKey of CID 173482593?
The InChIKey is ATAGULKTMAIPOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H33B/c1-2-21(22)13-15-4-3-5-19(9-15,14-21)20-10-16-6-17(11-20)8-18(7-16)12-20/h15-18H,2-14H2,1H3.
What are the key properties of CID 173482593?
CID 173482593 has a molecular weight of 296.31 g/mol, XLogP of 5.91, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173482593 is sourced from PubChem (CID 173482593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).