About bicyclo[2.2.1]heptane;cyclohexane;ethanamine
bicyclo[2.2.1]heptane;cyclohexane;ethanamine (PubChem CID 159865221) has the molecular formula C21H52N4
and a molecular weight of 360.68 g/mol. Its IUPAC name is bicyclo[2.2.1]heptane;cyclohexane;ethanamine.
Molecular Properties
| Compound Name | bicyclo[2.2.1]heptane;cyclohexane;ethanamine |
| PubChem CID | 159865221 |
| Molecular Formula | C21H52N4 |
| Molecular Weight | 360.68 g/mol |
| Exact Mass | 360.42 |
| IUPAC Name | bicyclo[2.2.1]heptane;cyclohexane;ethanamine |
| SMILES | C1CC2CCC1C2.C1CCCCC1.CCN.CCN.CCN.CCN |
| InChI | InChI=1S/C7H12.C6H12.4C2H7N/c1-2-7-4-3-6(1)5-7;1-2-4-6-5-3-1;4*1-2-3/h6-7H,1-5H2;1-6H2;4*2-3H2,1H3 |
| InChIKey | NRQLTHQOLXJRJB-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.68 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze bicyclo[2.2.1]heptane;cyclohexane;ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[2.2.1]heptane;cyclohexane;ethanamine?
The IUPAC name of bicyclo[2.2.1]heptane;cyclohexane;ethanamine (CID 159865221) is bicyclo[2.2.1]heptane;cyclohexane;ethanamine.
What is the SMILES notation for bicyclo[2.2.1]heptane;cyclohexane;ethanamine?
The canonical SMILES for bicyclo[2.2.1]heptane;cyclohexane;ethanamine is C1CC2CCC1C2.C1CCCCC1.CCN.CCN.CCN.CCN.
What is the InChIKey of bicyclo[2.2.1]heptane;cyclohexane;ethanamine?
The InChIKey is NRQLTHQOLXJRJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12.C6H12.4C2H7N/c1-2-7-4-3-6(1)5-7;1-2-4-6-5-3-1;4*1-2-3/h6-7H,1-5H2;1-6H2;4*2-3H2,1H3.
What are the key properties of bicyclo[2.2.1]heptane;cyclohexane;ethanamine?
bicyclo[2.2.1]heptane;cyclohexane;ethanamine has a molecular weight of 360.68 g/mol, XLogP of 4.40, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[2.2.1]heptane;cyclohexane;ethanamine is sourced from PubChem (CID 159865221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).