C15H17N3O2S2 — CID 177433519
(4S)-2-[(1E,3E)-4-(5-pyrrolidin-1-yl-1,3-thiazol-2-yl)buta-1,3-dienyl]-4,5-dihydro-1,3-thiazole-4-carboxylic acid (PubChem CID 177433519) has the molecular formula C15H17N3O2S2 and a molecular weight of 335.45 g/mol. Its IUPAC name is (4S)-2-[(1E,3E)-4-(5-pyrrolidin-1-yl-1,3-thiazol-2-yl)buta-1,3-dienyl]-4,5-dihydro-1,3-thiazole-4-carboxylic acid.
| Compound Name | (4S)-2-[(1E,3E)-4-(5-pyrrolidin-1-yl-1,3-thiazol-2-yl)buta-1,3-dienyl]-4,5-dihydro-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 177433519 |
| Molecular Formula | C15H17N3O2S2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | (4S)-2-[(1E,3E)-4-(5-pyrrolidin-1-yl-1,3-thiazol-2-yl)buta-1,3-dienyl]-4,5-dihydro-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(O)[C@H]1CSC(/C=C/C=C/c2ncc(N3CCCC3)s2)=N1 |
| InChI | InChI=1S/C15H17N3O2S2/c19-15(20)11-10-21-13(17-11)6-2-1-5-12-16-9-14(22-12)18-7-3-4-8-18/h1-2,5-6,9,11H,3-4,7-8,10H2,(H,19,20)/b5-1+,6-2+/t11-/m1/s1 |
| InChIKey | YOIPOGQZZPHOAN-IUJJAZLQSA-N |
| XLogP | 2.91 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|