C13H10O — CID 177435064
14-oxatetracyclo[9.2.1.02,10.04,8]tetradeca-2(10),3,5,8,12-pentaene (PubChem CID 177435064) has the molecular formula C13H10O and a molecular weight of 182.22 g/mol. Its IUPAC name is 14-oxatetracyclo[9.2.1.02,10.04,8]tetradeca-2(10),3,5,8,12-pentaene.
| Compound Name | 14-oxatetracyclo[9.2.1.02,10.04,8]tetradeca-2(10),3,5,8,12-pentaene |
|---|---|
| PubChem CID | 177435064 |
| Molecular Formula | C13H10O |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.07 |
| IUPAC Name | 14-oxatetracyclo[9.2.1.02,10.04,8]tetradeca-2(10),3,5,8,12-pentaene |
| SMILES | C1=Cc2cc3c(cc2C1)C1C=CC3O1 |
| InChI | InChI=1S/C13H10O/c1-2-8-6-10-11(7-9(8)3-1)13-5-4-12(10)14-13/h1-2,4-7,12-13H,3H2 |
| InChIKey | NBUGHOLFGJPCBT-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|