C22H36O2P+ — CID 177438388
decyl-oxo-[(1R,2S)-2-phenylcyclohexyl]oxyphosphanium (PubChem CID 177438388) has the molecular formula C22H36O2P+ and a molecular weight of 363.50 g/mol. Its IUPAC name is decyl-oxo-[(1R,2S)-2-phenylcyclohexyl]oxyphosphanium.
| Compound Name | decyl-oxo-[(1R,2S)-2-phenylcyclohexyl]oxyphosphanium |
|---|---|
| PubChem CID | 177438388 |
| Molecular Formula | C22H36O2P+ |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.24 |
| IUPAC Name | decyl-oxo-[(1R,2S)-2-phenylcyclohexyl]oxyphosphanium |
| SMILES | CCCCCCCCCC[P+](=O)O[C@@H]1CCCC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C22H36O2P/c1-2-3-4-5-6-7-8-14-19-25(23)24-22-18-13-12-17-21(22)20-15-10-9-11-16-20/h9-11,15-16,21-22H,2-8,12-14,17-19H2,1H3/q+1/t21-,22+/m0/s1 |
| InChIKey | GUBJOTWDUPTGFT-FCHUYYIVSA-N |
| XLogP | 7.61 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|