C17H15NO3 — CID 177441765
3-[(E)-1-naphthalen-1-yl-1-oxobut-2-en-2-yl]-1,3-oxazolidin-2-one (PubChem CID 177441765) has the molecular formula C17H15NO3 and a molecular weight of 281.31 g/mol. Its IUPAC name is 3-[(E)-1-naphthalen-1-yl-1-oxobut-2-en-2-yl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[(E)-1-naphthalen-1-yl-1-oxobut-2-en-2-yl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 177441765 |
| Molecular Formula | C17H15NO3 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 3-[(E)-1-naphthalen-1-yl-1-oxobut-2-en-2-yl]-1,3-oxazolidin-2-one |
| SMILES | C/C=C(\C(=O)c1cccc2ccccc12)N1CCOC1=O |
| InChI | InChI=1S/C17H15NO3/c1-2-15(18-10-11-21-17(18)20)16(19)14-9-5-7-12-6-3-4-8-13(12)14/h2-9H,10-11H2,1H3/b15-2+ |
| InChIKey | VTSXRGRHQPXJHL-RSSMCMFDSA-N |
| XLogP | 3.38 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|