C31H26N4O2 — CID 177442997
ethyl (1S,5S)-1,3,5,6-tetraphenyl-2,6-diaza-3-azonia-4-azanidabicyclo[3.3.0]octa-2,7-diene-8-carboxylate (PubChem CID 177442997) has the molecular formula C31H26N4O2 and a molecular weight of 486.58 g/mol. Its IUPAC name is ethyl (1S,5S)-1,3,5,6-tetraphenyl-2,6-diaza-3-azonia-4-azanidabicyclo[3.3.0]octa-2,7-diene-8-carboxylate.
| Compound Name | ethyl (1S,5S)-1,3,5,6-tetraphenyl-2,6-diaza-3-azonia-4-azanidabicyclo[3.3.0]octa-2,7-diene-8-carboxylate |
|---|---|
| PubChem CID | 177442997 |
| Molecular Formula | C31H26N4O2 |
| Molecular Weight | 486.58 g/mol |
| Exact Mass | 486.21 |
| IUPAC Name | ethyl (1S,5S)-1,3,5,6-tetraphenyl-2,6-diaza-3-azonia-4-azanidabicyclo[3.3.0]octa-2,7-diene-8-carboxylate |
| SMILES | CCOC(=O)C1=CN(c2ccccc2)[C@@]2(c3ccccc3)[N-][N+](c3ccccc3)=N[C@@]12c1ccccc1 |
| InChI | InChI=1S/C31H26N4O2/c1-2-37-29(36)28-23-34(26-19-11-5-12-20-26)31(25-17-9-4-10-18-25)30(28,24-15-7-3-8-16-24)32-35(33-31)27-21-13-6-14-22-27/h3-23H,2H2,1H3/t30-,31+/m0/s1 |
| InChIKey | TUEJYGJJWCTANL-IOWSJCHKSA-N |
| XLogP | 6.80 |
| TPSA | 59.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.58 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|