C20H16O3S — CID 177444653
(4Z)-4-[(4-methylphenoxy)methylidene]-2,3-dihydrothiopyrano[2,3-b]chromen-5-one (PubChem CID 177444653) has the molecular formula C20H16O3S and a molecular weight of 336.41 g/mol. Its IUPAC name is (4Z)-4-[(4-methylphenoxy)methylidene]-2,3-dihydrothiopyrano[2,3-b]chromen-5-one.
| Compound Name | (4Z)-4-[(4-methylphenoxy)methylidene]-2,3-dihydrothiopyrano[2,3-b]chromen-5-one |
|---|---|
| PubChem CID | 177444653 |
| Molecular Formula | C20H16O3S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | (4Z)-4-[(4-methylphenoxy)methylidene]-2,3-dihydrothiopyrano[2,3-b]chromen-5-one |
| SMILES | Cc1ccc(O/C=C2/CCSc3oc4ccccc4c(=O)c32)cc1 |
| InChI | InChI=1S/C20H16O3S/c1-13-6-8-15(9-7-13)22-12-14-10-11-24-20-18(14)19(21)16-4-2-3-5-17(16)23-20/h2-9,12H,10-11H2,1H3/b14-12- |
| InChIKey | DIOQRWOQNFBCEU-OWBHPGMISA-N |
| XLogP | 5.02 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|