C18H13Br3O2 — CID 85435004
3-bromo-2-[1,2-dibromo-2-(4-methylphenyl)ethyl]chromen-4-one (PubChem CID 85435004) has the molecular formula C18H13Br3O2 and a molecular weight of 501.01 g/mol. Its IUPAC name is 3-bromo-2-[1,2-dibromo-2-(4-methylphenyl)ethyl]chromen-4-one.
| Compound Name | 3-bromo-2-[1,2-dibromo-2-(4-methylphenyl)ethyl]chromen-4-one |
|---|---|
| PubChem CID | 85435004 |
| Molecular Formula | C18H13Br3O2 |
| Molecular Weight | 501.01 g/mol |
| Exact Mass | 497.85 |
| IUPAC Name | 3-bromo-2-[1,2-dibromo-2-(4-methylphenyl)ethyl]chromen-4-one |
| SMILES | Cc1ccc(C(Br)C(Br)c2oc3ccccc3c(=O)c2Br)cc1 |
| InChI | InChI=1S/C18H13Br3O2/c1-10-6-8-11(9-7-10)14(19)15(20)18-16(21)17(22)12-4-2-3-5-13(12)23-18/h2-9,14-15H,1H3 |
| InChIKey | APNRWYCIWKBXKE-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.01 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|