About CID 177445100
CID 177445100 (PubChem CID 177445100) has the molecular formula C36H20Cl4F2N
and a molecular weight of 646.37 g/mol.
Molecular Properties
| Compound Name | CID 177445100 |
| PubChem CID | 177445100 |
| Molecular Formula | C36H20Cl4F2N |
| Molecular Weight | 646.37 g/mol |
| Exact Mass | 644.03 |
| IUPAC Name | — |
| SMILES | Fc1cncc(F)c1[C](c1c(Cl)ccc(-c2ccccc2)c1Cl)c1c(Cl)cc(-c2ccccc2)c(-c2ccccc2)c1Cl |
| InChI | InChI=1S/C36H20Cl4F2N/c37-26-17-16-24(21-10-4-1-5-11-21)35(39)31(26)34(33-28(41)19-43-20-29(33)42)32-27(38)18-25(22-12-6-2-7-13-22)30(36(32)40)23-14-8-3-9-15-23/h1-20H |
| InChIKey | JRZQCYAMRKEXKW-UHFFFAOYSA-N |
| XLogP | 11.99 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 646.37 |
| LogP ≤ 5 | 11.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 177445100 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 177445100?
The IUPAC name of CID 177445100 (CID 177445100) is not available.
What is the SMILES notation for CID 177445100?
The canonical SMILES for CID 177445100 is Fc1cncc(F)c1[C](c1c(Cl)ccc(-c2ccccc2)c1Cl)c1c(Cl)cc(-c2ccccc2)c(-c2ccccc2)c1Cl.
What is the InChIKey of CID 177445100?
The InChIKey is JRZQCYAMRKEXKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H20Cl4F2N/c37-26-17-16-24(21-10-4-1-5-11-21)35(39)31(26)34(33-28(41)19-43-20-29(33)42)32-27(38)18-25(22-12-6-2-7-13-22)30(36(32)40)23-14-8-3-9-15-23/h1-20H.
What are the key properties of CID 177445100?
CID 177445100 has a molecular weight of 646.37 g/mol, XLogP of 11.99, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 177445100 is sourced from PubChem (CID 177445100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).