C16H19N3O2S — CID 177445316
[(4S,5E)-1-azido-6-phenylsulfanylocta-5,7-dien-4-yl] acetate (PubChem CID 177445316) has the molecular formula C16H19N3O2S and a molecular weight of 317.41 g/mol. Its IUPAC name is [(4S,5E)-1-azido-6-phenylsulfanylocta-5,7-dien-4-yl] acetate.
| Compound Name | [(4S,5E)-1-azido-6-phenylsulfanylocta-5,7-dien-4-yl] acetate |
|---|---|
| PubChem CID | 177445316 |
| Molecular Formula | C16H19N3O2S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | [(4S,5E)-1-azido-6-phenylsulfanylocta-5,7-dien-4-yl] acetate |
| SMILES | C=C/C(=C\[C@H](CCCN=[N+]=[N-])OC(C)=O)Sc1ccccc1 |
| InChI | InChI=1S/C16H19N3O2S/c1-3-15(22-16-9-5-4-6-10-16)12-14(21-13(2)20)8-7-11-18-19-17/h3-6,9-10,12,14H,1,7-8,11H2,2H3/b15-12+/t14-/m0/s1 |
| InChIKey | LCLPSBPSZCXVJL-YEQVNJDRSA-N |
| XLogP | 4.87 |
| TPSA | 75.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|